About 4-ethylpyrrolidin-2-one;2-methylpropane;propane
4-ethylpyrrolidin-2-one;2-methylpropane;propane (PubChem CID 144516344) has the molecular formula C13H29NO
and a molecular weight of 215.38 g/mol. Its IUPAC name is 4-ethylpyrrolidin-2-one;2-methylpropane;propane.
Molecular Properties
| Compound Name | 4-ethylpyrrolidin-2-one;2-methylpropane;propane |
| PubChem CID | 144516344 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | 4-ethylpyrrolidin-2-one;2-methylpropane;propane |
| SMILES | CC(C)C.CCC.CCC1CNC(=O)C1 |
| InChI | InChI=1S/C6H11NO.C4H10.C3H8/c1-2-5-3-6(8)7-4-5;1-4(2)3;1-3-2/h5H,2-4H2,1H3,(H,7,8);4H,1-3H3;3H2,1-2H3 |
| InChIKey | VUTKGXPUSTWKFJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethylpyrrolidin-2-one;2-methylpropane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylpyrrolidin-2-one;2-methylpropane;propane?
The IUPAC name of 4-ethylpyrrolidin-2-one;2-methylpropane;propane (CID 144516344) is 4-ethylpyrrolidin-2-one;2-methylpropane;propane.
What is the SMILES notation for 4-ethylpyrrolidin-2-one;2-methylpropane;propane?
The canonical SMILES for 4-ethylpyrrolidin-2-one;2-methylpropane;propane is CC(C)C.CCC.CCC1CNC(=O)C1.
What is the InChIKey of 4-ethylpyrrolidin-2-one;2-methylpropane;propane?
The InChIKey is VUTKGXPUSTWKFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C4H10.C3H8/c1-2-5-3-6(8)7-4-5;1-4(2)3;1-3-2/h5H,2-4H2,1H3,(H,7,8);4H,1-3H3;3H2,1-2H3.
What are the key properties of 4-ethylpyrrolidin-2-one;2-methylpropane;propane?
4-ethylpyrrolidin-2-one;2-methylpropane;propane has a molecular weight of 215.38 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylpyrrolidin-2-one;2-methylpropane;propane is sourced from PubChem (CID 144516344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).