C24H25N3O4 — CID 144516379
4-[[7-[6-(oxan-4-yloxy)-3-pyridinyl]quinolin-5-yl]oxymethyl]pyrrolidin-2-one (PubChem CID 144516379) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 4-[[7-[6-(oxan-4-yloxy)-3-pyridinyl]quinolin-5-yl]oxymethyl]pyrrolidin-2-one.
| Compound Name | 4-[[7-[6-(oxan-4-yloxy)-3-pyridinyl]quinolin-5-yl]oxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 144516379 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 4-[[7-[6-(oxan-4-yloxy)-3-pyridinyl]quinolin-5-yl]oxymethyl]pyrrolidin-2-one |
| SMILES | O=C1CC(COc2cc(-c3ccc(OC4CCOCC4)nc3)cc3ncccc23)CN1 |
| InChI | InChI=1S/C24H25N3O4/c28-23-10-16(13-26-23)15-30-22-12-18(11-21-20(22)2-1-7-25-21)17-3-4-24(27-14-17)31-19-5-8-29-9-6-19/h1-4,7,11-12,14,16,19H,5-6,8-10,13,15H2,(H,26,28) |
| InChIKey | ROXGANZRPAIODB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |