About 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide
2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide (PubChem CID 144516742) has the molecular formula C11H14F2N2O2
and a molecular weight of 244.24 g/mol. Its IUPAC name is 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide.
Molecular Properties
| Compound Name | 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide |
| PubChem CID | 144516742 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide |
| SMILES | C=C(F)C(=O)N[C@H]1CCC[C@H]1NC(=O)C(=C)F |
| InChI | InChI=1S/C11H14F2N2O2/c1-6(12)10(16)14-8-4-3-5-9(8)15-11(17)7(2)13/h8-9H,1-5H2,(H,14,16)(H,15,17)/t8-,9+ |
| InChIKey | OEAFSVFLUSPVKJ-DTORHVGOSA-N |
| XLogP | 1.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide?
The IUPAC name of 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide (CID 144516742) is 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide.
What is the SMILES notation for 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide?
The canonical SMILES for 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide is C=C(F)C(=O)N[C@H]1CCC[C@H]1NC(=O)C(=C)F.
What is the InChIKey of 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide?
The InChIKey is OEAFSVFLUSPVKJ-DTORHVGOSA-N. The full InChI is InChI=1S/C11H14F2N2O2/c1-6(12)10(16)14-8-4-3-5-9(8)15-11(17)7(2)13/h8-9H,1-5H2,(H,14,16)(H,15,17)/t8-,9+.
What are the key properties of 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide?
2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide has a molecular weight of 244.24 g/mol, XLogP of 1.11, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[(1S,2R)-2-(2-fluoroprop-2-enoylamino)cyclopentyl]prop-2-enamide is sourced from PubChem (CID 144516742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).