About 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane
3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane (PubChem CID 144517002) has the molecular formula C14H20OS
and a molecular weight of 236.38 g/mol. Its IUPAC name is 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane.
Molecular Properties
| Compound Name | 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane |
| PubChem CID | 144517002 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane |
| SMILES | CCS(C)(C)OC1=CCCc2ccccc21 |
| InChI | InChI=1S/C14H20OS/c1-4-16(2,3)15-14-11-7-9-12-8-5-6-10-13(12)14/h5-6,8,10-11H,4,7,9H2,1-3H3 |
| InChIKey | GSLQTAYLCFRRAC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane?
The IUPAC name of 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane (CID 144517002) is 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane.
What is the SMILES notation for 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane?
The canonical SMILES for 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane is CCS(C)(C)OC1=CCCc2ccccc21.
What is the InChIKey of 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane?
The InChIKey is GSLQTAYLCFRRAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20OS/c1-4-16(2,3)15-14-11-7-9-12-8-5-6-10-13(12)14/h5-6,8,10-11H,4,7,9H2,1-3H3.
What are the key properties of 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane?
3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane has a molecular weight of 236.38 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydronaphthalen-1-yloxy-ethyl-dimethyl-λ4-sulfane is sourced from PubChem (CID 144517002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).