C18H8O9 — CID 144517583
12-hydroxy-12-methoxy-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,16,18-tetrone (PubChem CID 144517583) has the molecular formula C18H8O9 and a molecular weight of 368.25 g/mol. Its IUPAC name is 12-hydroxy-12-methoxy-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,16,18-tetrone.
| Compound Name | 12-hydroxy-12-methoxy-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,16,18-tetrone |
|---|---|
| PubChem CID | 144517583 |
| Molecular Formula | C18H8O9 |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 12-hydroxy-12-methoxy-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,16,18-tetrone |
| SMILES | COC1(O)c2cc3c(cc2Oc2cc4c(cc21)C(=O)OC4=O)C(=O)OC3=O |
| InChI | InChI=1S/C18H8O9/c1-24-18(23)10-2-6-8(16(21)26-14(6)19)4-12(10)25-13-5-9-7(3-11(13)18)15(20)27-17(9)22/h2-5,23H,1H3 |
| InChIKey | AGRRBNDEQKEEDC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|