C23H17F6NO4 — CID 144517660
4-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(2-methylbutanoyl)benzaldehyde (PubChem CID 144517660) has the molecular formula C23H17F6NO4 and a molecular weight of 485.38 g/mol. Its IUPAC name is 4-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(2-methylbutanoyl)benzaldehyde.
| Compound Name | 4-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(2-methylbutanoyl)benzaldehyde |
|---|---|
| PubChem CID | 144517660 |
| Molecular Formula | C23H17F6NO4 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 4-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(2-methylbutanoyl)benzaldehyde |
| SMILES | CCC(C)C(=O)c1cc(C(c2ccc3c(c2)C(=O)NC3=O)(C(F)(F)F)C(F)(F)F)ccc1C=O |
| InChI | InChI=1S/C23H17F6NO4/c1-3-11(2)18(32)16-8-13(5-4-12(16)10-31)21(22(24,25)26,23(27,28)29)14-6-7-15-17(9-14)20(34)30-19(15)33/h4-11H,3H2,1-2H3,(H,30,33,34) |
| InChIKey | QYFFKEGVFOIOLL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|