About methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane
methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane (PubChem CID 144517685) has the molecular formula C15H28
and a molecular weight of 208.39 g/mol. Its IUPAC name is methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane.
Molecular Properties
| Compound Name | methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane |
| PubChem CID | 144517685 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane |
| SMILES | C.CC=CC(C)C1C=CC=CC1.CCC |
| InChI | InChI=1S/C11H16.C3H8.CH4/c1-3-7-10(2)11-8-5-4-6-9-11;1-3-2;/h3-8,10-11H,9H2,1-2H3;3H2,1-2H3;1H4 |
| InChIKey | PNAAPCQYSYBTEA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane?
The IUPAC name of methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane (CID 144517685) is methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane.
What is the SMILES notation for methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane?
The canonical SMILES for methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane is C.CC=CC(C)C1C=CC=CC1.CCC.
What is the InChIKey of methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane?
The InChIKey is PNAAPCQYSYBTEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C3H8.CH4/c1-3-7-10(2)11-8-5-4-6-9-11;1-3-2;/h3-8,10-11H,9H2,1-2H3;3H2,1-2H3;1H4.
What are the key properties of methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane?
methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane has a molecular weight of 208.39 g/mol, XLogP of 5.38, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-pent-3-en-2-ylcyclohexa-1,3-diene;propane is sourced from PubChem (CID 144517685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).