About (E)-3-aminobut-1-ene-1-thiol;methylhydrazine
(E)-3-aminobut-1-ene-1-thiol;methylhydrazine (PubChem CID 144517889) has the molecular formula C5H15N3S
and a molecular weight of 149.26 g/mol. Its IUPAC name is (E)-3-aminobut-1-ene-1-thiol;methylhydrazine.
Molecular Properties
| Compound Name | (E)-3-aminobut-1-ene-1-thiol;methylhydrazine |
| PubChem CID | 144517889 |
| Molecular Formula | C5H15N3S |
| Molecular Weight | 149.26 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | (E)-3-aminobut-1-ene-1-thiol;methylhydrazine |
| SMILES | CC(N)/C=C/S.CNN |
| InChI | InChI=1S/C4H9NS.CH6N2/c1-4(5)2-3-6;1-3-2/h2-4,6H,5H2,1H3;3H,2H2,1H3/b3-2+; |
| InChIKey | ROJJLYRCKNMCTD-SQQVDAMQSA-N |
| XLogP | -0.14 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-aminobut-1-ene-1-thiol;methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-aminobut-1-ene-1-thiol;methylhydrazine?
The IUPAC name of (E)-3-aminobut-1-ene-1-thiol;methylhydrazine (CID 144517889) is (E)-3-aminobut-1-ene-1-thiol;methylhydrazine.
What is the SMILES notation for (E)-3-aminobut-1-ene-1-thiol;methylhydrazine?
The canonical SMILES for (E)-3-aminobut-1-ene-1-thiol;methylhydrazine is CC(N)/C=C/S.CNN.
What is the InChIKey of (E)-3-aminobut-1-ene-1-thiol;methylhydrazine?
The InChIKey is ROJJLYRCKNMCTD-SQQVDAMQSA-N. The full InChI is InChI=1S/C4H9NS.CH6N2/c1-4(5)2-3-6;1-3-2/h2-4,6H,5H2,1H3;3H,2H2,1H3/b3-2+;.
What are the key properties of (E)-3-aminobut-1-ene-1-thiol;methylhydrazine?
(E)-3-aminobut-1-ene-1-thiol;methylhydrazine has a molecular weight of 149.26 g/mol, XLogP of -0.14, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-aminobut-1-ene-1-thiol;methylhydrazine is sourced from PubChem (CID 144517889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).