C12H21N3 — CID 144518192
(2Z)-N',2-dimethyl-N-piperidin-3-ylpenta-2,4-dienimidamide (PubChem CID 144518192) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is (2Z)-N',2-dimethyl-N-piperidin-3-ylpenta-2,4-dienimidamide.
| Compound Name | (2Z)-N',2-dimethyl-N-piperidin-3-ylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 144518192 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (2Z)-N',2-dimethyl-N-piperidin-3-ylpenta-2,4-dienimidamide |
| SMILES | C=C/C=C(C)\C(=N/C)NC1CCCNC1 |
| InChI | InChI=1S/C12H21N3/c1-4-6-10(2)12(13-3)15-11-7-5-8-14-9-11/h4,6,11,14H,1,5,7-9H2,2-3H3,(H,13,15)/b10-6- |
| InChIKey | YYLZZXHAPLHDOO-POHAHGRESA-N |
| XLogP | 1.49 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|