C19H28 — CID 144518773
2-butan-2-yl-4-[(1E)-2,3-dimethylbuta-1,3-dienyl]-1,3,5-trimethylbenzene (PubChem CID 144518773) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is 2-butan-2-yl-4-[(1E)-2,3-dimethylbuta-1,3-dienyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-butan-2-yl-4-[(1E)-2,3-dimethylbuta-1,3-dienyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 144518773 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 2-butan-2-yl-4-[(1E)-2,3-dimethylbuta-1,3-dienyl]-1,3,5-trimethylbenzene |
| SMILES | C=C(C)/C(C)=C/c1c(C)cc(C)c(C(C)CC)c1C |
| InChI | InChI=1S/C19H28/c1-9-13(4)19-16(7)10-15(6)18(17(19)8)11-14(5)12(2)3/h10-11,13H,2,9H2,1,3-8H3/b14-11+ |
| InChIKey | HVOVZWHCTIMVEQ-SDNWHVSQSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|