About 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine
1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine (PubChem CID 144518882) has the molecular formula C21H46N4O2
and a molecular weight of 386.63 g/mol. Its IUPAC name is 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine |
| PubChem CID | 144518882 |
| Molecular Formula | C21H46N4O2 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.36 |
| IUPAC Name | 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine |
| SMILES | CN1CCNCC1.COCC1CCCN(C)C1.COCCN1CCCCC1 |
| InChI | InChI=1S/2C8H17NO.C5H12N2/c1-9-5-3-4-8(6-9)7-10-2;1-10-8-7-9-5-3-2-4-6-9;1-7-4-2-6-3-5-7/h8H,3-7H2,1-2H3;2-8H2,1H3;6H,2-5H2,1H3 |
| InChIKey | CWGMGWHQLPISDU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine?
The IUPAC name of 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine (CID 144518882) is 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine.
What is the SMILES notation for 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine?
The canonical SMILES for 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine is CN1CCNCC1.COCC1CCCN(C)C1.COCCN1CCCCC1.
What is the InChIKey of 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine?
The InChIKey is CWGMGWHQLPISDU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H17NO.C5H12N2/c1-9-5-3-4-8(6-9)7-10-2;1-10-8-7-9-5-3-2-4-6-9;1-7-4-2-6-3-5-7/h8H,3-7H2,1-2H3;2-8H2,1H3;6H,2-5H2,1H3.
What are the key properties of 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine?
1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine has a molecular weight of 386.63 g/mol, XLogP of 1.61, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)piperidine;3-(methoxymethyl)-1-methylpiperidine;1-methylpiperazine is sourced from PubChem (CID 144518882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).