C14H13ClN6O2 — CID 144518887
6-(3-chloro-4-cyclopropyloxyphenyl)-N-hydrazinylidene-5-hydroxypyrimidine-4-carboximidamide (PubChem CID 144518887) has the molecular formula C14H13ClN6O2 and a molecular weight of 332.75 g/mol. Its IUPAC name is 6-(3-chloro-4-cyclopropyloxyphenyl)-N-hydrazinylidene-5-hydroxypyrimidine-4-carboximidamide.
| Compound Name | 6-(3-chloro-4-cyclopropyloxyphenyl)-N-hydrazinylidene-5-hydroxypyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 144518887 |
| Molecular Formula | C14H13ClN6O2 |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 6-(3-chloro-4-cyclopropyloxyphenyl)-N-hydrazinylidene-5-hydroxypyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N=N\N)c1ncnc(-c2ccc(OC3CC3)c(Cl)c2)c1O |
| InChI | InChI=1S/C14H13ClN6O2/c15-9-5-7(1-4-10(9)23-8-2-3-8)11-13(22)12(19-6-18-11)14(16)20-21-17/h1,4-6,8,22H,2-3H2,(H3,16,17,20) |
| InChIKey | GQOYPDJXPMISBQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|