C18H28N2O — CID 144519506
N-[(2E,5E)-2-ethenyl-7-ethylimino-5-methyl-4-methylidenehepta-2,5-dienyl]-N-propan-2-ylacetamide (PubChem CID 144519506) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is N-[(2E,5E)-2-ethenyl-7-ethylimino-5-methyl-4-methylidenehepta-2,5-dienyl]-N-propan-2-ylacetamide.
| Compound Name | N-[(2E,5E)-2-ethenyl-7-ethylimino-5-methyl-4-methylidenehepta-2,5-dienyl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 144519506 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-[(2E,5E)-2-ethenyl-7-ethylimino-5-methyl-4-methylidenehepta-2,5-dienyl]-N-propan-2-ylacetamide |
| SMILES | C=C/C(=C\C(=C)/C(C)=C/C=N/CC)CN(C(C)=O)C(C)C |
| InChI | InChI=1S/C18H28N2O/c1-8-18(13-20(14(3)4)17(7)21)12-16(6)15(5)10-11-19-9-2/h8,10-12,14H,1,6,9,13H2,2-5,7H3/b15-10+,18-12+,19-11+ |
| InChIKey | UMAFXDZTDSVVBK-QVINVJKISA-N |
| XLogP | 3.95 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|