2-fluorobenzenediazonium fluoride

C6H4F2N2 — CID 14451953

IUPAC2-fluorobenzenediazonium fluoride
SMILESN#[N+]c1ccccc1F.[F-]
InChIInChI=1S/C6H4FN2.FH/c7-5-3-1-2-4-6(5)9-8;/h1-4H;1H/q+1;/p-1
InChIKeyOIIDPZUYIQTIFT-UHFFFAOYSA-M
MW142.11 g/mol
LogP-0.69
Rot. Bonds

About 2-fluorobenzenediazonium fluoride

2-fluorobenzenediazonium fluoride (PubChem CID 14451953) has the molecular formula C6H4F2N2 and a molecular weight of 142.11 g/mol. Its IUPAC name is 2-fluorobenzenediazonium fluoride.

Molecular Properties

Compound Name2-fluorobenzenediazonium fluoride
PubChem CID14451953
Molecular FormulaC6H4F2N2
Molecular Weight142.11 g/mol
Exact Mass142.03
IUPAC Name2-fluorobenzenediazonium fluoride
SMILESN#[N+]c1ccccc1F.[F-]
InChIInChI=1S/C6H4FN2.FH/c7-5-3-1-2-4-6(5)9-8;/h1-4H;1H/q+1;/p-1
InChIKeyOIIDPZUYIQTIFT-UHFFFAOYSA-M
XLogP-0.69
TPSA28.15 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.11
LogP ≤ 5-0.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Azo_group', 'substructure': 'N/A'}

Analyze 2-fluorobenzenediazonium fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluorobenzenediazonium fluoride?
The IUPAC name of 2-fluorobenzenediazonium fluoride (CID 14451953) is 2-fluorobenzenediazonium fluoride.
What is the SMILES notation for 2-fluorobenzenediazonium fluoride?
The canonical SMILES for 2-fluorobenzenediazonium fluoride is N#[N+]c1ccccc1F.[F-].
What is the InChIKey of 2-fluorobenzenediazonium fluoride?
The InChIKey is OIIDPZUYIQTIFT-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H4FN2.FH/c7-5-3-1-2-4-6(5)9-8;/h1-4H;1H/q+1;/p-1.
What are the key properties of 2-fluorobenzenediazonium fluoride?
2-fluorobenzenediazonium fluoride has a molecular weight of 142.11 g/mol, XLogP of -0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobenzenediazonium fluoride is sourced from PubChem (CID 14451953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).