About 2-fluorobenzenediazonium fluoride
2-fluorobenzenediazonium fluoride (PubChem CID 14451953) has the molecular formula C6H4F2N2
and a molecular weight of 142.11 g/mol. Its IUPAC name is 2-fluorobenzenediazonium fluoride.
Molecular Properties
| Compound Name | 2-fluorobenzenediazonium fluoride |
| PubChem CID | 14451953 |
| Molecular Formula | C6H4F2N2 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 2-fluorobenzenediazonium fluoride |
| SMILES | N#[N+]c1ccccc1F.[F-] |
| InChI | InChI=1S/C6H4FN2.FH/c7-5-3-1-2-4-6(5)9-8;/h1-4H;1H/q+1;/p-1 |
| InChIKey | OIIDPZUYIQTIFT-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorobenzenediazonium fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobenzenediazonium fluoride?
The IUPAC name of 2-fluorobenzenediazonium fluoride (CID 14451953) is 2-fluorobenzenediazonium fluoride.
What is the SMILES notation for 2-fluorobenzenediazonium fluoride?
The canonical SMILES for 2-fluorobenzenediazonium fluoride is N#[N+]c1ccccc1F.[F-].
What is the InChIKey of 2-fluorobenzenediazonium fluoride?
The InChIKey is OIIDPZUYIQTIFT-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H4FN2.FH/c7-5-3-1-2-4-6(5)9-8;/h1-4H;1H/q+1;/p-1.
What are the key properties of 2-fluorobenzenediazonium fluoride?
2-fluorobenzenediazonium fluoride has a molecular weight of 142.11 g/mol, XLogP of -0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobenzenediazonium fluoride is sourced from PubChem (CID 14451953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).