About 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene
1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene (PubChem CID 144519543) has the molecular formula C15H19F3
and a molecular weight of 256.31 g/mol. Its IUPAC name is 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene.
Molecular Properties
| Compound Name | 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene |
| PubChem CID | 144519543 |
| Molecular Formula | C15H19F3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene |
| SMILES | CC1CCC=C(F)C1.Cc1cc(F)c(C)c(F)c1 |
| InChI | InChI=1S/C8H8F2.C7H11F/c1-5-3-7(9)6(2)8(10)4-5;1-6-3-2-4-7(8)5-6/h3-4H,1-2H3;4,6H,2-3,5H2,1H3 |
| InChIKey | XUOKGVXTNSRTRE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene?
The IUPAC name of 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene (CID 144519543) is 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene.
What is the SMILES notation for 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene?
The canonical SMILES for 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene is CC1CCC=C(F)C1.Cc1cc(F)c(C)c(F)c1.
What is the InChIKey of 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene?
The InChIKey is XUOKGVXTNSRTRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2.C7H11F/c1-5-3-7(9)6(2)8(10)4-5;1-6-3-2-4-7(8)5-6/h3-4H,1-2H3;4,6H,2-3,5H2,1H3.
What are the key properties of 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene?
1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene has a molecular weight of 256.31 g/mol, XLogP of 5.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoro-2,5-dimethylbenzene;1-fluoro-5-methylcyclohexene is sourced from PubChem (CID 144519543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).