About 4-aminobenzenediazonium
4-aminobenzenediazonium (PubChem CID 14451960) has the molecular formula C6H6N3+
and a molecular weight of 120.13 g/mol. Its IUPAC name is 4-aminobenzenediazonium.
Molecular Properties
| Compound Name | 4-aminobenzenediazonium |
| PubChem CID | 14451960 |
| Molecular Formula | C6H6N3+ |
| Molecular Weight | 120.13 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 4-aminobenzenediazonium |
| SMILES | N#[N+]c1ccc(N)cc1 |
| InChI | InChI=1S/C6H6N3/c7-5-1-3-6(9-8)4-2-5/h1-4H,7H2/q+1 |
| InChIKey | JDQOQWKEOLQHKB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.13 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzenediazonium?
The IUPAC name of 4-aminobenzenediazonium (CID 14451960) is 4-aminobenzenediazonium.
What is the SMILES notation for 4-aminobenzenediazonium?
The canonical SMILES for 4-aminobenzenediazonium is N#[N+]c1ccc(N)cc1.
What is the InChIKey of 4-aminobenzenediazonium?
The InChIKey is JDQOQWKEOLQHKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N3/c7-5-1-3-6(9-8)4-2-5/h1-4H,7H2/q+1.
What are the key properties of 4-aminobenzenediazonium?
4-aminobenzenediazonium has a molecular weight of 120.13 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzenediazonium is sourced from PubChem (CID 14451960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).