C17H18FN7 — CID 144519987
4-N-[(3-amino-5-fluorophenyl)methyl]-5-methanimidoyl-2-N-(1-methylpyrazol-4-yl)pyridine-2,4-diamine (PubChem CID 144519987) has the molecular formula C17H18FN7 and a molecular weight of 339.38 g/mol. Its IUPAC name is 4-N-[(3-amino-5-fluorophenyl)methyl]-5-methanimidoyl-2-N-(1-methylpyrazol-4-yl)pyridine-2,4-diamine.
| Compound Name | 4-N-[(3-amino-5-fluorophenyl)methyl]-5-methanimidoyl-2-N-(1-methylpyrazol-4-yl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 144519987 |
| Molecular Formula | C17H18FN7 |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-N-[(3-amino-5-fluorophenyl)methyl]-5-methanimidoyl-2-N-(1-methylpyrazol-4-yl)pyridine-2,4-diamine |
| SMILES | [H]/N=C/c1cnc(Nc2cnn(C)c2)cc1NCc1cc(N)cc(F)c1 |
| InChI | InChI=1S/C17H18FN7/c1-25-10-15(9-23-25)24-17-5-16(12(6-19)8-22-17)21-7-11-2-13(18)4-14(20)3-11/h2-6,8-10,19H,7,20H2,1H3,(H2,21,22,24)/b19-6+ |
| InChIKey | QCAIVGVDJXXUEN-KPSZGOFPSA-N |
| XLogP | 2.89 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|