About [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate
[(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate (PubChem CID 144520860) has the molecular formula C10H9N3O3S2
and a molecular weight of 283.33 g/mol. Its IUPAC name is [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate.
Molecular Properties
| Compound Name | [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate |
| PubChem CID | 144520860 |
| Molecular Formula | C10H9N3O3S2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate |
| SMILES | CS(=O)(=O)O/N=C(\C#N)c1nc2c(s1)=CCCC=2 |
| InChI | InChI=1S/C10H9N3O3S2/c1-18(14,15)16-13-8(6-11)10-12-7-4-2-3-5-9(7)17-10/h4-5H,2-3H2,1H3/b13-8+ |
| InChIKey | HECQWWUMUPMUQK-MDWZMJQESA-N |
| XLogP | -0.30 |
| TPSA | 92.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate?
The IUPAC name of [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate (CID 144520860) is [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate.
What is the SMILES notation for [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate?
The canonical SMILES for [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate is CS(=O)(=O)O/N=C(\C#N)c1nc2c(s1)=CCCC=2.
What is the InChIKey of [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate?
The InChIKey is HECQWWUMUPMUQK-MDWZMJQESA-N. The full InChI is InChI=1S/C10H9N3O3S2/c1-18(14,15)16-13-8(6-11)10-12-7-4-2-3-5-9(7)17-10/h4-5H,2-3H2,1H3/b13-8+.
What are the key properties of [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate?
[(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate has a molecular weight of 283.33 g/mol, XLogP of -0.30, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[cyano(5,6-dihydro-1,3-benzothiazol-2-yl)methylidene]amino] methanesulfonate is sourced from PubChem (CID 144520860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).