About (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate
(2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate (PubChem CID 144520882) has the molecular formula C15H23BrO2
and a molecular weight of 315.25 g/mol. Its IUPAC name is (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate.
Molecular Properties
| Compound Name | (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate |
| PubChem CID | 144520882 |
| Molecular Formula | C15H23BrO2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate |
| SMILES | CCC1(OC(=O)CBr)C(C)CC(C)C=C2CC1C2 |
| InChI | InChI=1S/C15H23BrO2/c1-4-15(18-14(17)9-16)11(3)5-10(2)6-12-7-13(15)8-12/h6,10-11,13H,4-5,7-9H2,1-3H3/b12-6- |
| InChIKey | OEDIBTWTJTZOCO-SDQBBNPISA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate?
The IUPAC name of (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate (CID 144520882) is (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate.
What is the SMILES notation for (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate?
The canonical SMILES for (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate is CCC1(OC(=O)CBr)C(C)CC(C)C=C2CC1C2.
What is the InChIKey of (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate?
The InChIKey is OEDIBTWTJTZOCO-SDQBBNPISA-N. The full InChI is InChI=1S/C15H23BrO2/c1-4-15(18-14(17)9-16)11(3)5-10(2)6-12-7-13(15)8-12/h6,10-11,13H,4-5,7-9H2,1-3H3/b12-6-.
What are the key properties of (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate?
(2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate has a molecular weight of 315.25 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-3,5-dimethyl-2-bicyclo[5.1.1]non-6-enyl) 2-bromoacetate is sourced from PubChem (CID 144520882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).