C10H12N2 — CID 144521035
(1Z,2Z,5Z,7Z)-3-methyl-9-methylidene-4H-diazecine (PubChem CID 144521035) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is (1Z,2Z,5Z,7Z)-3-methyl-9-methylidene-4H-diazecine.
| Compound Name | (1Z,2Z,5Z,7Z)-3-methyl-9-methylidene-4H-diazecine |
|---|---|
| PubChem CID | 144521035 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | (1Z,2Z,5Z,7Z)-3-methyl-9-methylidene-4H-diazecine |
| SMILES | C=C1/C=C\C=C/C/C(C)=N\N=C/1 |
| InChI | InChI=1S/C10H12N2/c1-9-6-4-3-5-7-10(2)12-11-8-9/h3-6,8H,1,7H2,2H3/b5-3-,6-4-,11-8-,12-10- |
| InChIKey | RGGIZIFSIXBXFU-CKIMRTOZSA-N |
| XLogP | 2.51 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |