C14H27N3 — CID 144521909
ethane;(1Z,7E)-4-ethyl-7-N,8-N,6-trimethyl-3,6-dihydroazocine-7,8-diamine (PubChem CID 144521909) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;(1Z,7E)-4-ethyl-7-N,8-N,6-trimethyl-3,6-dihydroazocine-7,8-diamine.
| Compound Name | ethane;(1Z,7E)-4-ethyl-7-N,8-N,6-trimethyl-3,6-dihydroazocine-7,8-diamine |
|---|---|
| PubChem CID | 144521909 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | ethane;(1Z,7E)-4-ethyl-7-N,8-N,6-trimethyl-3,6-dihydroazocine-7,8-diamine |
| SMILES | CC.CCC1=CC(C)/C(NC)=C(NC)\N=C/C1 |
| InChI | InChI=1S/C12H21N3.C2H6/c1-5-10-6-7-15-12(14-4)11(13-3)9(2)8-10;1-2/h7-9,13-14H,5-6H2,1-4H3;1-2H3/b10-8?,12-11+,15-7-; |
| InChIKey | QDGCXCLGMPAZHY-GGOUBJGQSA-N |
| XLogP | 3.07 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|