About bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene
bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene (PubChem CID 144521970) has the molecular formula C14H18N2
and a molecular weight of 214.31 g/mol. Its IUPAC name is bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene.
Molecular Properties
| Compound Name | bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene |
| PubChem CID | 144521970 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene |
| SMILES | C=C(C)/C=C\C(=C)/N=N/C(=C)/C=C/C(=C)C |
| InChI | InChI=1S/C14H18N2/c1-11(2)7-9-13(5)15-16-14(6)10-8-12(3)4/h7-10H,1,3,5-6H2,2,4H3/b9-7-,10-8-,16-15+ |
| InChIKey | YCNMKQISHBBVNX-ASSKPWGTSA-N |
| XLogP | 4.73 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene?
The IUPAC name of bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene (CID 144521970) is bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene.
What is the SMILES notation for bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene?
The canonical SMILES for bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene is C=C(C)/C=C\C(=C)/N=N/C(=C)/C=C/C(=C)C.
What is the InChIKey of bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene?
The InChIKey is YCNMKQISHBBVNX-ASSKPWGTSA-N. The full InChI is InChI=1S/C14H18N2/c1-11(2)7-9-13(5)15-16-14(6)10-8-12(3)4/h7-10H,1,3,5-6H2,2,4H3/b9-7-,10-8-,16-15+.
What are the key properties of bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene?
bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene has a molecular weight of 214.31 g/mol, XLogP of 4.73, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(3Z)-5-methylhexa-1,3,5-trien-2-yl]diazene is sourced from PubChem (CID 144521970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).