About pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate
pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate (PubChem CID 144522135) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate.
Molecular Properties
| Compound Name | pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate |
| PubChem CID | 144522135 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate |
| SMILES | CCC(CC)OC(=O)Cc1ncn[nH]1 |
| InChI | InChI=1S/C9H15N3O2/c1-3-7(4-2)14-9(13)5-8-10-6-11-12-8/h6-7H,3-5H2,1-2H3,(H,10,11,12) |
| InChIKey | PKFJXSABDHPKMR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate?
The IUPAC name of pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate (CID 144522135) is pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate.
What is the SMILES notation for pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate?
The canonical SMILES for pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate is CCC(CC)OC(=O)Cc1ncn[nH]1.
What is the InChIKey of pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate?
The InChIKey is PKFJXSABDHPKMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-3-7(4-2)14-9(13)5-8-10-6-11-12-8/h6-7H,3-5H2,1-2H3,(H,10,11,12).
What are the key properties of pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate?
pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate has a molecular weight of 197.24 g/mol, XLogP of 1.08, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-yl 2-(1H-1,2,4-triazol-5-yl)acetate is sourced from PubChem (CID 144522135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).