C23H34N4O4S — CID 144522181
3,7-dimethyl-6-[[2-methyl-2-[methyl-(2-nitrophenyl)sulfanylamino]propanoyl]amino]bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 144522181) has the molecular formula C23H34N4O4S and a molecular weight of 462.62 g/mol. Its IUPAC name is 3,7-dimethyl-6-[[2-methyl-2-[methyl-(2-nitrophenyl)sulfanylamino]propanoyl]amino]bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 3,7-dimethyl-6-[[2-methyl-2-[methyl-(2-nitrophenyl)sulfanylamino]propanoyl]amino]bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 144522181 |
| Molecular Formula | C23H34N4O4S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 3,7-dimethyl-6-[[2-methyl-2-[methyl-(2-nitrophenyl)sulfanylamino]propanoyl]amino]bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CC1CC2CC(CC(C)(C(N)=O)C2)C1NC(=O)C(C)(C)N(C)Sc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H34N4O4S/c1-14-10-15-11-16(13-23(4,12-15)20(24)28)19(14)25-21(29)22(2,3)26(5)32-18-9-7-6-8-17(18)27(30)31/h6-9,14-16,19H,10-13H2,1-5H3,(H2,24,28)(H,25,29) |
| InChIKey | IOECWUBYIXZIOE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|