C24H36BrN3O2S — CID 144522442
1-[(2-bromophenyl)sulfanylamino]cyclobutane-1-carbaldehyde;3,7-dimethyl-6-(methylamino)bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 144522442) has the molecular formula C24H36BrN3O2S and a molecular weight of 510.54 g/mol. Its IUPAC name is 1-[(2-bromophenyl)sulfanylamino]cyclobutane-1-carbaldehyde;3,7-dimethyl-6-(methylamino)bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 1-[(2-bromophenyl)sulfanylamino]cyclobutane-1-carbaldehyde;3,7-dimethyl-6-(methylamino)bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 144522442 |
| Molecular Formula | C24H36BrN3O2S |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 1-[(2-bromophenyl)sulfanylamino]cyclobutane-1-carbaldehyde;3,7-dimethyl-6-(methylamino)bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CNC1C(C)CC2CC1CC(C)(C(N)=O)C2.O=CC1(NSc2ccccc2Br)CCC1 |
| InChI | InChI=1S/C13H24N2O.C11H12BrNOS/c1-8-4-9-5-10(11(8)15-3)7-13(2,6-9)12(14)16;12-9-4-1-2-5-10(9)15-13-11(8-14)6-3-7-11/h8-11,15H,4-7H2,1-3H3,(H2,14,16);1-2,4-5,8,13H,3,6-7H2 |
| InChIKey | BRQQISJQYNFWQM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|