C22H32ClN3O2S — CID 144522571
6-[[2-[(2-chlorophenyl)sulfanylamino]-2-methylpropanoyl]amino]-3,7-dimethylbicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 144522571) has the molecular formula C22H32ClN3O2S and a molecular weight of 438.04 g/mol. Its IUPAC name is 6-[[2-[(2-chlorophenyl)sulfanylamino]-2-methylpropanoyl]amino]-3,7-dimethylbicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 6-[[2-[(2-chlorophenyl)sulfanylamino]-2-methylpropanoyl]amino]-3,7-dimethylbicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 144522571 |
| Molecular Formula | C22H32ClN3O2S |
| Molecular Weight | 438.04 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 6-[[2-[(2-chlorophenyl)sulfanylamino]-2-methylpropanoyl]amino]-3,7-dimethylbicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CC1CC2CC(CC(C)(C(N)=O)C2)C1NC(=O)C(C)(C)NSc1ccccc1Cl |
| InChI | InChI=1S/C22H32ClN3O2S/c1-13-9-14-10-15(12-22(4,11-14)19(24)27)18(13)25-20(28)21(2,3)26-29-17-8-6-5-7-16(17)23/h5-8,13-15,18,26H,9-12H2,1-4H3,(H2,24,27)(H,25,28) |
| InChIKey | IAGSKXBKVSCWFC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.04 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|