C22H33ClN2OS — CID 144522717
2-[(3-chlorophenyl)sulfanylamino]-N-(3-ethyl-7-methyl-2-bicyclo[3.3.1]nonanyl)-2-methylpropanamide (PubChem CID 144522717) has the molecular formula C22H33ClN2OS and a molecular weight of 409.04 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)sulfanylamino]-N-(3-ethyl-7-methyl-2-bicyclo[3.3.1]nonanyl)-2-methylpropanamide.
| Compound Name | 2-[(3-chlorophenyl)sulfanylamino]-N-(3-ethyl-7-methyl-2-bicyclo[3.3.1]nonanyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 144522717 |
| Molecular Formula | C22H33ClN2OS |
| Molecular Weight | 409.04 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[(3-chlorophenyl)sulfanylamino]-N-(3-ethyl-7-methyl-2-bicyclo[3.3.1]nonanyl)-2-methylpropanamide |
| SMILES | CCC1CC2CC(C)CC(C2)C1NC(=O)C(C)(C)NSc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H33ClN2OS/c1-5-16-11-15-9-14(2)10-17(12-15)20(16)24-21(26)22(3,4)25-27-19-8-6-7-18(23)13-19/h6-8,13-17,20,25H,5,9-12H2,1-4H3,(H,24,26) |
| InChIKey | BTOKBIHENYATQG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.04 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|