C26H38FN3O2S — CID 144522865
6-[[1-[(3-fluoro-4-methylphenyl)sulfanylamino]cyclohexanecarbonyl]amino]-3,7-dimethylbicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 144522865) has the molecular formula C26H38FN3O2S and a molecular weight of 475.67 g/mol. Its IUPAC name is 6-[[1-[(3-fluoro-4-methylphenyl)sulfanylamino]cyclohexanecarbonyl]amino]-3,7-dimethylbicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 6-[[1-[(3-fluoro-4-methylphenyl)sulfanylamino]cyclohexanecarbonyl]amino]-3,7-dimethylbicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 144522865 |
| Molecular Formula | C26H38FN3O2S |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 6-[[1-[(3-fluoro-4-methylphenyl)sulfanylamino]cyclohexanecarbonyl]amino]-3,7-dimethylbicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | Cc1ccc(SNC2(C(=O)NC3C(C)CC4CC3CC(C)(C(N)=O)C4)CCCCC2)cc1F |
| InChI | InChI=1S/C26H38FN3O2S/c1-16-7-8-20(13-21(16)27)33-30-26(9-5-4-6-10-26)24(32)29-22-17(2)11-18-12-19(22)15-25(3,14-18)23(28)31/h7-8,13,17-19,22,30H,4-6,9-12,14-15H2,1-3H3,(H2,28,31)(H,29,32) |
| InChIKey | YHWJMMLPVPJSPD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|