C21H30ClFN2O2S — CID 144522875
2-[(2-chloro-4-fluorophenyl)sulfanylamino]-N-(7-hydroxy-3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)-2-methylpropanamide (PubChem CID 144522875) has the molecular formula C21H30ClFN2O2S and a molecular weight of 429.00 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)sulfanylamino]-N-(7-hydroxy-3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)-2-methylpropanamide.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)sulfanylamino]-N-(7-hydroxy-3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 144522875 |
| Molecular Formula | C21H30ClFN2O2S |
| Molecular Weight | 429.00 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)sulfanylamino]-N-(7-hydroxy-3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)-2-methylpropanamide |
| SMILES | CC1CC2CC(CC(C)(O)C2)C1NC(=O)C(C)(C)NSc1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H30ClFN2O2S/c1-12-7-13-8-14(11-21(4,27)10-13)18(12)24-19(26)20(2,3)25-28-17-6-5-15(23)9-16(17)22/h5-6,9,12-14,18,25,27H,7-8,10-11H2,1-4H3,(H,24,26) |
| InChIKey | PFUWWRTXXTXQAO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.00 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|