About dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate
dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate (PubChem CID 14452290) has the molecular formula C15H12N2O4
and a molecular weight of 284.27 g/mol. Its IUPAC name is dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate |
| PubChem CID | 14452290 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc2c([nH]c3ccccc32)c(C(=O)OC)n1 |
| InChI | InChI=1S/C15H12N2O4/c1-20-14(18)11-7-9-8-5-3-4-6-10(8)16-12(9)13(17-11)15(19)21-2/h3-7,16H,1-2H3 |
| InChIKey | VXRPWMNKCIAEHZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate?
The IUPAC name of dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate (CID 14452290) is dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate.
What is the SMILES notation for dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate?
The canonical SMILES for dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate is COC(=O)c1cc2c([nH]c3ccccc32)c(C(=O)OC)n1.
What is the InChIKey of dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate?
The InChIKey is VXRPWMNKCIAEHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O4/c1-20-14(18)11-7-9-8-5-3-4-6-10(8)16-12(9)13(17-11)15(19)21-2/h3-7,16H,1-2H3.
What are the key properties of dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate?
dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate has a molecular weight of 284.27 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 9H-pyrido[3,4-b]indole-1,3-dicarboxylate is sourced from PubChem (CID 14452290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).