C19H19N3O2 — CID 144523280
2-cyano-N-(3,5-dimethylphenyl)-N'-(3-methylphenyl)propanediamide (PubChem CID 144523280) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-cyano-N-(3,5-dimethylphenyl)-N'-(3-methylphenyl)propanediamide.
| Compound Name | 2-cyano-N-(3,5-dimethylphenyl)-N'-(3-methylphenyl)propanediamide |
|---|---|
| PubChem CID | 144523280 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-cyano-N-(3,5-dimethylphenyl)-N'-(3-methylphenyl)propanediamide |
| SMILES | Cc1cccc(NC(=O)C(C#N)C(=O)Nc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C19H19N3O2/c1-12-5-4-6-15(8-12)21-18(23)17(11-20)19(24)22-16-9-13(2)7-14(3)10-16/h4-10,17H,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | PWLINBSTYGIBEG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|