C10H13F3N2S — CID 144523390
2-[[(3E,5Z)-2-(trifluoromethyl)hepta-1,3,5-trien-3-yl]amino]ethanethioamide (PubChem CID 144523390) has the molecular formula C10H13F3N2S and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-[[(3E,5Z)-2-(trifluoromethyl)hepta-1,3,5-trien-3-yl]amino]ethanethioamide.
| Compound Name | 2-[[(3E,5Z)-2-(trifluoromethyl)hepta-1,3,5-trien-3-yl]amino]ethanethioamide |
|---|---|
| PubChem CID | 144523390 |
| Molecular Formula | C10H13F3N2S |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-[[(3E,5Z)-2-(trifluoromethyl)hepta-1,3,5-trien-3-yl]amino]ethanethioamide |
| SMILES | C=C(/C(=C\C=C/C)NCC(N)=S)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2S/c1-3-4-5-8(15-6-9(14)16)7(2)10(11,12)13/h3-5,15H,2,6H2,1H3,(H2,14,16)/b4-3-,8-5+ |
| InChIKey | FQNBSMPMUYLDNJ-HMRFFJRGSA-N |
| XLogP | 2.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|