C43H61NO — CID 144523729
1-(1-cyclohexa-1,5-dien-1-ylethyl)-2,4-dimethylbenzene;1-[4-[3-(3,5-dimethyl-2H-pyrrol-4-yl)-5,5,6-trimethylhept-6-enyl]phenyl]propan-2-one;ethane (PubChem CID 144523729) has the molecular formula C43H61NO and a molecular weight of 607.97 g/mol. Its IUPAC name is 1-(1-cyclohexa-1,5-dien-1-ylethyl)-2,4-dimethylbenzene;1-[4-[3-(3,5-dimethyl-2H-pyrrol-4-yl)-5,5,6-trimethylhept-6-enyl]phenyl]propan-2-one;ethane.
| Compound Name | 1-(1-cyclohexa-1,5-dien-1-ylethyl)-2,4-dimethylbenzene;1-[4-[3-(3,5-dimethyl-2H-pyrrol-4-yl)-5,5,6-trimethylhept-6-enyl]phenyl]propan-2-one;ethane |
|---|---|
| PubChem CID | 144523729 |
| Molecular Formula | C43H61NO |
| Molecular Weight | 607.97 g/mol |
| Exact Mass | 607.48 |
| IUPAC Name | 1-(1-cyclohexa-1,5-dien-1-ylethyl)-2,4-dimethylbenzene;1-[4-[3-(3,5-dimethyl-2H-pyrrol-4-yl)-5,5,6-trimethylhept-6-enyl]phenyl]propan-2-one;ethane |
| SMILES | C=C(C)C(C)(C)CC(CCc1ccc(CC(C)=O)cc1)C1=C(C)CN=C1C.CC.Cc1ccc(C(C)C2=CCCC=C2)c(C)c1 |
| InChI | InChI=1S/C25H35NO.C16H20.C2H6/c1-17(2)25(6,7)15-23(24-18(3)16-26-20(24)5)13-12-21-8-10-22(11-9-21)14-19(4)27;1-12-9-10-16(13(2)11-12)14(3)15-7-5-4-6-8-15;1-2/h8-11,23H,1,12-16H2,2-7H3;5,7-11,14H,4,6H2,1-3H3;1-2H3 |
| InChIKey | SXXUFPMPVHBYBO-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.97 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|