About ethane;methyl N-ethenylethanimidothioate;propane
ethane;methyl N-ethenylethanimidothioate;propane (PubChem CID 144524047) has the molecular formula C10H23NS
and a molecular weight of 189.37 g/mol. Its IUPAC name is ethane;methyl N-ethenylethanimidothioate;propane.
Molecular Properties
| Compound Name | ethane;methyl N-ethenylethanimidothioate;propane |
| PubChem CID | 144524047 |
| Molecular Formula | C10H23NS |
| Molecular Weight | 189.37 g/mol |
| Exact Mass | 189.16 |
| IUPAC Name | ethane;methyl N-ethenylethanimidothioate;propane |
| SMILES | C=C/N=C(\C)SC.CC.CCC |
| InChI | InChI=1S/C5H9NS.C3H8.C2H6/c1-4-6-5(2)7-3;1-3-2;1-2/h4H,1H2,2-3H3;3H2,1-2H3;1-2H3/b6-5+;; |
| InChIKey | YGBWTJXVGOXOQU-TXOOBNKBSA-N |
| XLogP | 4.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl N-ethenylethanimidothioate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl N-ethenylethanimidothioate;propane?
The IUPAC name of ethane;methyl N-ethenylethanimidothioate;propane (CID 144524047) is ethane;methyl N-ethenylethanimidothioate;propane.
What is the SMILES notation for ethane;methyl N-ethenylethanimidothioate;propane?
The canonical SMILES for ethane;methyl N-ethenylethanimidothioate;propane is C=C/N=C(\C)SC.CC.CCC.
What is the InChIKey of ethane;methyl N-ethenylethanimidothioate;propane?
The InChIKey is YGBWTJXVGOXOQU-TXOOBNKBSA-N. The full InChI is InChI=1S/C5H9NS.C3H8.C2H6/c1-4-6-5(2)7-3;1-3-2;1-2/h4H,1H2,2-3H3;3H2,1-2H3;1-2H3/b6-5+;;.
What are the key properties of ethane;methyl N-ethenylethanimidothioate;propane?
ethane;methyl N-ethenylethanimidothioate;propane has a molecular weight of 189.37 g/mol, XLogP of 4.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl N-ethenylethanimidothioate;propane is sourced from PubChem (CID 144524047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).