C36H48O4P+ — CID 144524342
cyclohexa-1,5-dien-1-yl-[9-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)nonyl]-[(2E,4Z)-hexa-2,4-dien-3-yl]-phenylphosphanium (PubChem CID 144524342) has the molecular formula C36H48O4P+ and a molecular weight of 575.75 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yl-[9-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)nonyl]-[(2E,4Z)-hexa-2,4-dien-3-yl]-phenylphosphanium.
| Compound Name | cyclohexa-1,5-dien-1-yl-[9-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)nonyl]-[(2E,4Z)-hexa-2,4-dien-3-yl]-phenylphosphanium |
|---|---|
| PubChem CID | 144524342 |
| Molecular Formula | C36H48O4P+ |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.33 |
| IUPAC Name | cyclohexa-1,5-dien-1-yl-[9-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)nonyl]-[(2E,4Z)-hexa-2,4-dien-3-yl]-phenylphosphanium |
| SMILES | C/C=C\C(=C/C)[P+](CCCCCCCCCC1=C(C)C(=O)C(OC)=C(OC)C1=O)(C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C36H48O4P/c1-6-21-29(7-2)41(30-22-15-13-16-23-30,31-24-17-14-18-25-31)27-20-12-10-8-9-11-19-26-32-28(3)33(37)35(39-4)36(40-5)34(32)38/h6-7,13,15-17,21-25H,8-12,14,18-20,26-27H2,1-5H3/q+1/b21-6-,29-7+ |
| InChIKey | YSMLYVNYHGSHNJ-SLSZGLNOSA-N |
| XLogP | 9.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|