About 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane
2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 144525170) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane |
| PubChem CID | 144525170 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CN1CC2CC1CN2.CN1CC2CCC1C2 |
| InChI | InChI=1S/C7H13N.C6H12N2/c1-8-5-6-2-3-7(8)4-6;1-8-4-5-2-6(8)3-7-5/h6-7H,2-5H2,1H3;5-7H,2-4H2,1H3 |
| InChIKey | VSFORMOISIHWTH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane (CID 144525170) is 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane is CN1CC2CC1CN2.CN1CC2CCC1C2.
What is the InChIKey of 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is VSFORMOISIHWTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C6H12N2/c1-8-5-6-2-3-7(8)4-6;1-8-4-5-2-6(8)3-7-5/h6-7H,2-5H2,1H3;5-7H,2-4H2,1H3.
What are the key properties of 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane?
2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 223.36 g/mol, XLogP of 0.76, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-azabicyclo[2.2.1]heptane;2-methyl-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 144525170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).