About 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane
3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane (PubChem CID 144525202) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane.
Molecular Properties
| Compound Name | 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane |
| PubChem CID | 144525202 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane |
| SMILES | CC.CN1CC2CN(C)C2C1 |
| InChI | InChI=1S/C7H14N2.C2H6/c1-8-3-6-4-9(2)7(6)5-8;1-2/h6-7H,3-5H2,1-2H3;1-2H3 |
| InChIKey | ZDFLGRFASUKZPO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane?
The IUPAC name of 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane (CID 144525202) is 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane.
What is the SMILES notation for 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane?
The canonical SMILES for 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane is CC.CN1CC2CN(C)C2C1.
What is the InChIKey of 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane?
The InChIKey is ZDFLGRFASUKZPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.C2H6/c1-8-3-6-4-9(2)7(6)5-8;1-2/h6-7H,3-5H2,1-2H3;1-2H3.
What are the key properties of 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane?
3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane has a molecular weight of 156.27 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-3,6-diazabicyclo[3.2.0]heptane;ethane is sourced from PubChem (CID 144525202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).