C25H30N4O2S — CID 144525548
N'-[6-methyl-2-(1-oxo-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)quinolin-4-yl]-N-(oxetan-3-yl)propane-1,3-diamine (PubChem CID 144525548) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is N'-[6-methyl-2-(1-oxo-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)quinolin-4-yl]-N-(oxetan-3-yl)propane-1,3-diamine.
| Compound Name | N'-[6-methyl-2-(1-oxo-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)quinolin-4-yl]-N-(oxetan-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 144525548 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N'-[6-methyl-2-(1-oxo-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)quinolin-4-yl]-N-(oxetan-3-yl)propane-1,3-diamine |
| SMILES | Cc1ccc2nc(N3CCS(=O)c4ccccc4C3)cc(NCCCNC3COC3)c2c1 |
| InChI | InChI=1S/C25H30N4O2S/c1-18-7-8-22-21(13-18)23(27-10-4-9-26-20-16-31-17-20)14-25(28-22)29-11-12-32(30)24-6-3-2-5-19(24)15-29/h2-3,5-8,13-14,20,26H,4,9-12,15-17H2,1H3,(H,27,28) |
| InChIKey | MGMFYDRBICCLPF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|