About methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine
methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine (PubChem CID 144525685) has the molecular formula C9H19NS2
and a molecular weight of 205.39 g/mol. Its IUPAC name is methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine.
Molecular Properties
| Compound Name | methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine |
| PubChem CID | 144525685 |
| Molecular Formula | C9H19NS2 |
| Molecular Weight | 205.39 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine |
| SMILES | C=NC(=C)/C(C)=C\C.CS.CS |
| InChI | InChI=1S/C7H11N.2CH4S/c1-5-6(2)7(3)8-4;2*1-2/h5H,3-4H2,1-2H3;2*2H,1H3/b6-5-;; |
| InChIKey | VPBAVLQXBFWDBD-XNOMRPDFSA-N |
| XLogP | 3.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine?
The IUPAC name of methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine (CID 144525685) is methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine.
What is the SMILES notation for methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine?
The canonical SMILES for methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine is C=NC(=C)/C(C)=C\C.CS.CS.
What is the InChIKey of methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine?
The InChIKey is VPBAVLQXBFWDBD-XNOMRPDFSA-N. The full InChI is InChI=1S/C7H11N.2CH4S/c1-5-6(2)7(3)8-4;2*1-2/h5H,3-4H2,1-2H3;2*2H,1H3/b6-5-;;.
What are the key properties of methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine?
methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine has a molecular weight of 205.39 g/mol, XLogP of 3.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;N-[(3Z)-3-methylpenta-1,3-dien-2-yl]methanimine is sourced from PubChem (CID 144525685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).