C24H27N3O2 — CID 144525727
6-[(E)-3-[5-[(3E)-5-methylhexa-1,3,5-trien-3-yl]-2,3,4,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 144525727) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 6-[(E)-3-[5-[(3E)-5-methylhexa-1,3,5-trien-3-yl]-2,3,4,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-[5-[(3E)-5-methylhexa-1,3,5-trien-3-yl]-2,3,4,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 144525727 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 6-[(E)-3-[5-[(3E)-5-methylhexa-1,3,5-trien-3-yl]-2,3,4,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | C=C/C(=C\C(=C)C)C1=CCN(C(=O)/C=C/c2cnc3c(c2)CCC(=O)N3)CCC1 |
| InChI | InChI=1S/C24H27N3O2/c1-4-19(14-17(2)3)20-6-5-12-27(13-11-20)23(29)10-7-18-15-21-8-9-22(28)26-24(21)25-16-18/h4,7,10-11,14-16H,1-2,5-6,8-9,12-13H2,3H3,(H,25,26,28)/b10-7+,19-14+ |
| InChIKey | JDMVXGRPXYILCC-AOEVHAJLSA-N |
| XLogP | 4.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|