C13H22N2O — CID 144526420
(Z)-N-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]-N',2-dimethylprop-1-ene-1,3-diamine (PubChem CID 144526420) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (Z)-N-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]-N',2-dimethylprop-1-ene-1,3-diamine.
| Compound Name | (Z)-N-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]-N',2-dimethylprop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 144526420 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (Z)-N-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]-N',2-dimethylprop-1-ene-1,3-diamine |
| SMILES | C/C=C\C(=C/C=C/N/C=C(/C)CNC)OC |
| InChI | InChI=1S/C13H22N2O/c1-5-7-13(16-4)8-6-9-15-11-12(2)10-14-3/h5-9,11,14-15H,10H2,1-4H3/b7-5-,9-6+,12-11-,13-8+ |
| InChIKey | BGPRGAGPWUQKMO-WTRGRFALSA-N |
| XLogP | 2.32 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|