C27H27NO11 — CID 144526963
(7S,9S)-7-[[(3R,6S)-5-amino-6-hydroxy-2-oxabicyclo[3.1.1]heptan-3-yl]oxy]-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 144526963) has the molecular formula C27H27NO11 and a molecular weight of 541.51 g/mol. Its IUPAC name is (7S,9S)-7-[[(3R,6S)-5-amino-6-hydroxy-2-oxabicyclo[3.1.1]heptan-3-yl]oxy]-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-7-[[(3R,6S)-5-amino-6-hydroxy-2-oxabicyclo[3.1.1]heptan-3-yl]oxy]-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 144526963 |
| Molecular Formula | C27H27NO11 |
| Molecular Weight | 541.51 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | (7S,9S)-7-[[(3R,6S)-5-amino-6-hydroxy-2-oxabicyclo[3.1.1]heptan-3-yl]oxy]-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(=O)CO)C[C@@H]3O[C@H]1CC2(N)CC(O1)[C@H]2O |
| InChI | InChI=1S/C27H27NO11/c1-37-12-4-2-3-10-17(12)23(33)20-19(21(10)31)22(32)11-5-27(36,15(30)9-29)7-13(18(11)24(20)34)38-16-8-26(28)6-14(39-16)25(26)35/h2-4,13-14,16,25,29,32,34-36H,5-9,28H2,1H3/t13-,14?,16+,25+,26?,27-/m0/s1 |
| InChIKey | KVEAGLFPLSVVHD-ZLNFWCAYSA-N |
| XLogP | -0.24 |
| TPSA | 206.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.51 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|