C16H32O — CID 144527054
2-(5,6-dimethyldecan-2-yl)oxolane (PubChem CID 144527054) has the molecular formula C16H32O and a molecular weight of 240.43 g/mol. Its IUPAC name is 2-(5,6-dimethyldecan-2-yl)oxolane.
| Compound Name | 2-(5,6-dimethyldecan-2-yl)oxolane |
|---|---|
| PubChem CID | 144527054 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | 2-(5,6-dimethyldecan-2-yl)oxolane |
| SMILES | CCCCC(C)C(C)CCC(C)C1CCCO1 |
| InChI | InChI=1S/C16H32O/c1-5-6-8-13(2)14(3)10-11-15(4)16-9-7-12-17-16/h13-16H,5-12H2,1-4H3 |
| InChIKey | QXVSYKBRANUTTJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |