About ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol
ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol (PubChem CID 144527060) has the molecular formula C16H20O4S
and a molecular weight of 308.40 g/mol. Its IUPAC name is ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol |
| PubChem CID | 144527060 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol |
| SMILES | C=COc1ccc(S(=O)(=O)C2C=CC(O)=CC2)cc1.CC |
| InChI | InChI=1S/C14H14O4S.C2H6/c1-2-18-12-5-9-14(10-6-12)19(16,17)13-7-3-11(15)4-8-13;1-2/h2-7,9-10,13,15H,1,8H2;1-2H3 |
| InChIKey | FMIGDQSDYSLZAL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol?
The IUPAC name of ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol (CID 144527060) is ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol.
What is the SMILES notation for ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol?
The canonical SMILES for ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol is C=COc1ccc(S(=O)(=O)C2C=CC(O)=CC2)cc1.CC.
What is the InChIKey of ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol?
The InChIKey is FMIGDQSDYSLZAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O4S.C2H6/c1-2-18-12-5-9-14(10-6-12)19(16,17)13-7-3-11(15)4-8-13;1-2/h2-7,9-10,13,15H,1,8H2;1-2H3.
What are the key properties of ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol?
ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol has a molecular weight of 308.40 g/mol, XLogP of 3.78, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(4-ethenoxyphenyl)sulfonylcyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 144527060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).