C22H48O — CID 144527339
(3E)-3,4-dimethylhexa-1,3-dien-2-ol;ethane;2,3,4-trimethylpent-2-ene (PubChem CID 144527339) has the molecular formula C22H48O and a molecular weight of 328.63 g/mol. Its IUPAC name is (3E)-3,4-dimethylhexa-1,3-dien-2-ol;ethane;2,3,4-trimethylpent-2-ene.
| Compound Name | (3E)-3,4-dimethylhexa-1,3-dien-2-ol;ethane;2,3,4-trimethylpent-2-ene |
|---|---|
| PubChem CID | 144527339 |
| Molecular Formula | C22H48O |
| Molecular Weight | 328.63 g/mol |
| Exact Mass | 328.37 |
| IUPAC Name | (3E)-3,4-dimethylhexa-1,3-dien-2-ol;ethane;2,3,4-trimethylpent-2-ene |
| SMILES | C=C(O)/C(C)=C(\C)CC.CC.CC.CC.CC(C)=C(C)C(C)C |
| InChI | InChI=1S/C8H14O.C8H16.3C2H6/c1-5-6(2)7(3)8(4)9;1-6(2)8(5)7(3)4;3*1-2/h9H,4-5H2,1-3H3;6H,1-5H3;3*1-2H3/b7-6+;;;; |
| InChIKey | VPHPQKKTNCAZRP-MNPOOLNOSA-N |
| XLogP | 8.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.63 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|