C15H23F3N2O — CID 144527581
N-[2-[propyl-[(2E)-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]penta-2,4-dienyl]amino]ethyl]formamide (PubChem CID 144527581) has the molecular formula C15H23F3N2O and a molecular weight of 304.36 g/mol. Its IUPAC name is N-[2-[propyl-[(2E)-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]penta-2,4-dienyl]amino]ethyl]formamide.
| Compound Name | N-[2-[propyl-[(2E)-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]penta-2,4-dienyl]amino]ethyl]formamide |
|---|---|
| PubChem CID | 144527581 |
| Molecular Formula | C15H23F3N2O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[2-[propyl-[(2E)-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]penta-2,4-dienyl]amino]ethyl]formamide |
| SMILES | C=C/C=C(CN(CCC)CCNC=O)\C(=C/C)C(F)(F)F |
| InChI | InChI=1S/C15H23F3N2O/c1-4-7-13(14(6-3)15(16,17)18)11-20(9-5-2)10-8-19-12-21/h4,6-7,12H,1,5,8-11H2,2-3H3,(H,19,21)/b13-7-,14-6+ |
| InChIKey | OOROYMPLCMJSEV-GWFPFPHPSA-N |
| XLogP | 3.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|