C16H20FNO2S — CID 144527761
(E)-3-(4-fluorophenyl)-2-methyl-3-[[(Z)-2-methyl-1-methylsulfanylbut-1-enyl]amino]prop-2-enoic acid (PubChem CID 144527761) has the molecular formula C16H20FNO2S and a molecular weight of 309.41 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-2-methyl-3-[[(Z)-2-methyl-1-methylsulfanylbut-1-enyl]amino]prop-2-enoic acid.
| Compound Name | (E)-3-(4-fluorophenyl)-2-methyl-3-[[(Z)-2-methyl-1-methylsulfanylbut-1-enyl]amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 144527761 |
| Molecular Formula | C16H20FNO2S |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-2-methyl-3-[[(Z)-2-methyl-1-methylsulfanylbut-1-enyl]amino]prop-2-enoic acid |
| SMILES | CC/C(C)=C(/N/C(=C(\C)C(=O)O)c1ccc(F)cc1)SC |
| InChI | InChI=1S/C16H20FNO2S/c1-5-10(2)15(21-4)18-14(11(3)16(19)20)12-6-8-13(17)9-7-12/h6-9,18H,5H2,1-4H3,(H,19,20)/b14-11+,15-10- |
| InChIKey | ROQQUQVUYXXTCI-ZSCLYWQPSA-N |
| XLogP | 4.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|