About ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene
ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene (PubChem CID 144528012) has the molecular formula C13H30N2
and a molecular weight of 214.40 g/mol. Its IUPAC name is ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene.
Molecular Properties
| Compound Name | ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene |
| PubChem CID | 144528012 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene |
| SMILES | C=C(C)/C=C(C)\N=N\C.CC.CC.CC |
| InChI | InChI=1S/C7H12N2.3C2H6/c1-6(2)5-7(3)9-8-4;3*1-2/h5H,1H2,2-4H3;3*1-2H3/b7-5-,9-8+;;; |
| InChIKey | BZSRCEOQBRUVGQ-RGKZBXETSA-N |
| XLogP | 5.63 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene?
The IUPAC name of ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene (CID 144528012) is ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene.
What is the SMILES notation for ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene?
The canonical SMILES for ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene is C=C(C)/C=C(C)\N=N\C.CC.CC.CC.
What is the InChIKey of ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene?
The InChIKey is BZSRCEOQBRUVGQ-RGKZBXETSA-N. The full InChI is InChI=1S/C7H12N2.3C2H6/c1-6(2)5-7(3)9-8-4;3*1-2/h5H,1H2,2-4H3;3*1-2H3/b7-5-,9-8+;;;.
What are the key properties of ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene?
ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene has a molecular weight of 214.40 g/mol, XLogP of 5.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]diazene is sourced from PubChem (CID 144528012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).