About ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine
ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine (PubChem CID 144528051) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine.
Molecular Properties
| Compound Name | ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine |
| PubChem CID | 144528051 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine |
| SMILES | C=N/C(C)=C\C(C)=N\C.CC.CC |
| InChI | InChI=1S/C7H12N2.2C2H6/c1-6(8-3)5-7(2)9-4;2*1-2/h5H,3H2,1-2,4H3;2*1-2H3/b6-5-,9-7+;; |
| InChIKey | GMULVHRNBUFEEV-MDFLZTAESA-N |
| XLogP | 3.73 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine?
The IUPAC name of ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine (CID 144528051) is ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine.
What is the SMILES notation for ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine?
The canonical SMILES for ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine is C=N/C(C)=C\C(C)=N\C.CC.CC.
What is the InChIKey of ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine?
The InChIKey is GMULVHRNBUFEEV-MDFLZTAESA-N. The full InChI is InChI=1S/C7H12N2.2C2H6/c1-6(8-3)5-7(2)9-4;2*1-2/h5H,3H2,1-2,4H3;2*1-2H3/b6-5-,9-7+;;.
What are the key properties of ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine?
ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine has a molecular weight of 184.33 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine is sourced from PubChem (CID 144528051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).