C13H28N2 — CID 144528118
ethane;(Z)-2-N-ethyl-4-N-methylidenepent-3-ene-2,4-diimine;propane (PubChem CID 144528118) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is ethane;(Z)-2-N-ethyl-4-N-methylidenepent-3-ene-2,4-diimine;propane.
| Compound Name | ethane;(Z)-2-N-ethyl-4-N-methylidenepent-3-ene-2,4-diimine;propane |
|---|---|
| PubChem CID | 144528118 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | ethane;(Z)-2-N-ethyl-4-N-methylidenepent-3-ene-2,4-diimine;propane |
| SMILES | C=N/C(C)=C\C(C)=N\CC.CC.CCC |
| InChI | InChI=1S/C8H14N2.C3H8.C2H6/c1-5-10-8(3)6-7(2)9-4;1-3-2;1-2/h6H,4-5H2,1-3H3;3H2,1-2H3;1-2H3/b7-6-,10-8+;; |
| InChIKey | WBBNTYNSJGROIY-CTZBBKKDSA-N |
| XLogP | 4.51 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|